C14H28N6O4S2 — CID 25104448
N-(4-hydrazinyl-4-oxobutyl)-3-[[3-[(4-hydrazinyl-4-oxobutyl)amino]-3-oxopropyl]disulfanyl]propanamide (PubChem CID 25104448) has the molecular formula C14H28N6O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-(4-hydrazinyl-4-oxobutyl)-3-[[3-[(4-hydrazinyl-4-oxobutyl)amino]-3-oxopropyl]disulfanyl]propanamide.
| Compound Name | N-(4-hydrazinyl-4-oxobutyl)-3-[[3-[(4-hydrazinyl-4-oxobutyl)amino]-3-oxopropyl]disulfanyl]propanamide |
|---|---|
| PubChem CID | 25104448 |
| Molecular Formula | C14H28N6O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(4-hydrazinyl-4-oxobutyl)-3-[[3-[(4-hydrazinyl-4-oxobutyl)amino]-3-oxopropyl]disulfanyl]propanamide |
| SMILES | NNC(=O)CCCNC(=O)CCSSCCC(=O)NCCCC(=O)NN |
| InChI | InChI=1S/C14H28N6O4S2/c15-19-13(23)3-1-7-17-11(21)5-9-25-26-10-6-12(22)18-8-2-4-14(24)20-16/h1-10,15-16H2,(H,17,21)(H,18,22)(H,19,23)(H,20,24) |
| InChIKey | RSPKAPJXLWRGQY-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|