About 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone
3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 2510481) has the molecular formula C17H15N3O
and a molecular weight of 277.33 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
Molecular Properties
| Compound Name | 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| PubChem CID | 2510481 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H15N3O/c21-17(13-5-6-15-16(9-13)19-11-18-15)20-8-7-12-3-1-2-4-14(12)10-20/h1-6,9,11H,7-8,10H2,(H,18,19) |
| InChIKey | FUCSQHGPYAENJH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone?
The IUPAC name of 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone (CID 2510481) is 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
What is the SMILES notation for 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone?
The canonical SMILES for 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone is O=C(c1ccc2nc[nH]c2c1)N1CCc2ccccc2C1.
What is the InChIKey of 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone?
The InChIKey is FUCSQHGPYAENJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O/c21-17(13-5-6-15-16(9-13)19-11-18-15)20-8-7-12-3-1-2-4-14(12)10-20/h1-6,9,11H,7-8,10H2,(H,18,19).
What are the key properties of 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone?
3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone has a molecular weight of 277.33 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-benzimidazol-5-yl(3,4-dihydro-1H-isoquinolin-2-yl)methanone is sourced from PubChem (CID 2510481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).