C15H27Cl3O3Si — CID 25104864
(Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoic acid (PubChem CID 25104864) has the molecular formula C15H27Cl3O3Si and a molecular weight of 389.82 g/mol. Its IUPAC name is (Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoic acid.
| Compound Name | (Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoic acid |
|---|---|
| PubChem CID | 25104864 |
| Molecular Formula | C15H27Cl3O3Si |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trichloro-4-methyloct-4-enoic acid |
| SMILES | C/C(=C/CCC(Cl)(Cl)Cl)[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27Cl3O3Si/c1-11(8-7-9-15(16,17)18)12(10-13(19)20)21-22(5,6)14(2,3)4/h8,12H,7,9-10H2,1-6H3,(H,19,20)/b11-8-/t12-/m1/s1 |
| InChIKey | SDLHVPCKRIEYRH-NXIHDVOMSA-N |
| XLogP | 5.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|