C17H30O2Si — CID 25104915
(1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one (PubChem CID 25104915) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one.
| Compound Name | (1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one |
|---|---|
| PubChem CID | 25104915 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one |
| SMILES | C=C1C(=O)CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C17H30O2Si/c1-12-13-8-9-15(17(13,5)11-10-14(12)18)19-20(6,7)16(2,3)4/h13,15H,1,8-11H2,2-7H3/t13-,15-,17-/m0/s1 |
| InChIKey | BGQNSHSNNPMQRS-QRTARXTBSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|