C21H36O4Si — CID 25104917
(1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carbaldehyde (PubChem CID 25104917) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carbaldehyde.
| Compound Name | (1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carbaldehyde |
|---|---|
| PubChem CID | 25104917 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carbaldehyde |
| SMILES | CC1(C)OC[C@@]2(O1)C(C=O)=CC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C21H36O4Si/c1-18(2,3)26(7,8)24-17-10-9-16-20(17,6)12-11-15(13-22)21(16)14-23-19(4,5)25-21/h11,13,16-17H,9-10,12,14H2,1-8H3/t16-,17+,20+,21-/m1/s1 |
| InChIKey | YVXFMWIEZUVLMM-SQBLYHGDSA-N |
| XLogP | 4.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|