About (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one
(4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one (PubChem CID 25105092) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one.
Molecular Properties
| Compound Name | (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one |
| PubChem CID | 25105092 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one |
| SMILES | C=CC[C@@H](O)C(C)(C)C(C)=O |
| InChI | InChI=1S/C9H16O2/c1-5-6-8(11)9(3,4)7(2)10/h5,8,11H,1,6H2,2-4H3/t8-/m1/s1 |
| InChIKey | DHMZLGQHLUIOKY-MRVPVSSYSA-N |
| XLogP | 1.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one?
The IUPAC name of (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one (CID 25105092) is (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one.
What is the SMILES notation for (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one?
The canonical SMILES for (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one is C=CC[C@@H](O)C(C)(C)C(C)=O.
What is the InChIKey of (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one?
The InChIKey is DHMZLGQHLUIOKY-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H16O2/c1-5-6-8(11)9(3,4)7(2)10/h5,8,11H,1,6H2,2-4H3/t8-/m1/s1.
What are the key properties of (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one?
(4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one has a molecular weight of 156.22 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hydroxy-3,3-dimethylhept-6-en-2-one is sourced from PubChem (CID 25105092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).