C15H26O3 — CID 25105094
(4R,8R)-8-hydroxy-4-methoxy-5,5-dimethyldodeca-1,11-dien-6-one (PubChem CID 25105094) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (4R,8R)-8-hydroxy-4-methoxy-5,5-dimethyldodeca-1,11-dien-6-one.
| Compound Name | (4R,8R)-8-hydroxy-4-methoxy-5,5-dimethyldodeca-1,11-dien-6-one |
|---|---|
| PubChem CID | 25105094 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (4R,8R)-8-hydroxy-4-methoxy-5,5-dimethyldodeca-1,11-dien-6-one |
| SMILES | C=CCC[C@@H](O)CC(=O)C(C)(C)[C@@H](CC=C)OC |
| InChI | InChI=1S/C15H26O3/c1-6-8-10-12(16)11-13(17)15(3,4)14(18-5)9-7-2/h6-7,12,14,16H,1-2,8-11H2,3-5H3/t12-,14-/m1/s1 |
| InChIKey | SNDUGLKJZPXEKG-TZMCWYRMSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|