C35H49NO9 — CID 25105155
benzyl N-[1-[(2R,3R,4S,6R)-4-methoxy-6-[[(2R)-5-methoxyoxolan-2-yl]methyl]-5,5-dimethyl-3-(oxolan-2-yloxymethoxy)oxan-2-yl]-2-phenylethyl]carbamate (PubChem CID 25105155) has the molecular formula C35H49NO9 and a molecular weight of 627.78 g/mol. Its IUPAC name is benzyl N-[1-[(2R,3R,4S,6R)-4-methoxy-6-[[(2R)-5-methoxyoxolan-2-yl]methyl]-5,5-dimethyl-3-(oxolan-2-yloxymethoxy)oxan-2-yl]-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[1-[(2R,3R,4S,6R)-4-methoxy-6-[[(2R)-5-methoxyoxolan-2-yl]methyl]-5,5-dimethyl-3-(oxolan-2-yloxymethoxy)oxan-2-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 25105155 |
| Molecular Formula | C35H49NO9 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | benzyl N-[1-[(2R,3R,4S,6R)-4-methoxy-6-[[(2R)-5-methoxyoxolan-2-yl]methyl]-5,5-dimethyl-3-(oxolan-2-yloxymethoxy)oxan-2-yl]-2-phenylethyl]carbamate |
| SMILES | COC1CC[C@H](C[C@H]2O[C@H](C(Cc3ccccc3)NC(=O)OCc3ccccc3)[C@H](OCOC3CCCO3)[C@@H](OC)C2(C)C)O1 |
| InChI | InChI=1S/C35H49NO9/c1-35(2)28(21-26-17-18-29(38-3)44-26)45-31(32(33(35)39-4)43-23-42-30-16-11-19-40-30)27(20-24-12-7-5-8-13-24)36-34(37)41-22-25-14-9-6-10-15-25/h5-10,12-15,26-33H,11,16-23H2,1-4H3,(H,36,37)/t26-,27?,28-,29?,30?,31-,32+,33-/m1/s1 |
| InChIKey | YEGRTVFYRMEEDB-OHIJTRROSA-N |
| XLogP | 5.37 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|