C43H79ClNO3P — CID 25105456
4-[bis[(Z)-octadec-9-enoxy]phosphorylmethyl]-1-methylpyridin-1-ium chloride (PubChem CID 25105456) has the molecular formula C43H79ClNO3P and a molecular weight of 724.54 g/mol. Its IUPAC name is 4-[bis[(Z)-octadec-9-enoxy]phosphorylmethyl]-1-methylpyridin-1-ium chloride.
| Compound Name | 4-[bis[(Z)-octadec-9-enoxy]phosphorylmethyl]-1-methylpyridin-1-ium chloride |
|---|---|
| PubChem CID | 25105456 |
| Molecular Formula | C43H79ClNO3P |
| Molecular Weight | 724.54 g/mol |
| Exact Mass | 723.55 |
| IUPAC Name | 4-[bis[(Z)-octadec-9-enoxy]phosphorylmethyl]-1-methylpyridin-1-ium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)(Cc1cc[n+](C)cc1)OCCCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C43H79NO3P.ClH/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-40-46-48(45,42-43-36-38-44(3)39-37-43)47-41-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;/h18-21,36-39H,4-17,22-35,40-42H2,1-3H3;1H/q+1;/p-1/b20-18-,21-19-; |
| InChIKey | RNEBLAGRJRQZQY-YIQDKWKASA-M |
| XLogP | 11.32 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.54 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|