C22H26N4O2S — CID 25105708
N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]-2-phenylsulfanylacetamide (PubChem CID 25105708) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 25105708 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)NCCN1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C22H26N4O2S/c27-21(16-29-18-6-2-1-3-7-18)23-12-15-25-13-10-17(11-14-25)26-20-9-5-4-8-19(20)24-22(26)28/h1-9,17H,10-16H2,(H,23,27)(H,24,28) |
| InChIKey | DBVPQUXUULCVDM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |