C22H21F3N4O2S — CID 25105791
N-(cyclopropylmethyl)-2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carboxamide (PubChem CID 25105791) has the molecular formula C22H21F3N4O2S and a molecular weight of 462.50 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 25105791 |
| Molecular Formula | C22H21F3N4O2S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCC1CC1)c1cnc(N2CC3=C(CN(C(=O)c4ccccc4C(F)(F)F)C3)C2)s1 |
| InChI | InChI=1S/C22H21F3N4O2S/c23-22(24,25)17-4-2-1-3-16(17)20(31)28-9-14-11-29(12-15(14)10-28)21-27-8-18(32-21)19(30)26-7-13-5-6-13/h1-4,8,13H,5-7,9-12H2,(H,26,30) |
| InChIKey | GUPKQCHPORPYAG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|