C29H34N6O7S2 — CID 25105835
(2S,4R)-N-[(1R,2S)-2-ethenyl-1-(sulfamoylcarbamoyl)cyclopropyl]-1-[(2S)-2-hydroxy-3,3-dimethylbutanoyl]-4-(3-thiophen-2-ylquinoxalin-2-yl)oxypyrrolidine-2-carboxamide (PubChem CID 25105835) has the molecular formula C29H34N6O7S2 and a molecular weight of 642.76 g/mol. Its IUPAC name is (2S,4R)-N-[(1R,2S)-2-ethenyl-1-(sulfamoylcarbamoyl)cyclopropyl]-1-[(2S)-2-hydroxy-3,3-dimethylbutanoyl]-4-(3-thiophen-2-ylquinoxalin-2-yl)oxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R,2S)-2-ethenyl-1-(sulfamoylcarbamoyl)cyclopropyl]-1-[(2S)-2-hydroxy-3,3-dimethylbutanoyl]-4-(3-thiophen-2-ylquinoxalin-2-yl)oxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25105835 |
| Molecular Formula | C29H34N6O7S2 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | (2S,4R)-N-[(1R,2S)-2-ethenyl-1-(sulfamoylcarbamoyl)cyclopropyl]-1-[(2S)-2-hydroxy-3,3-dimethylbutanoyl]-4-(3-thiophen-2-ylquinoxalin-2-yl)oxypyrrolidine-2-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](Oc2nc3ccccc3nc2-c2cccs2)CN1C(=O)[C@@H](O)C(C)(C)C)C(=O)NS(N)(=O)=O |
| InChI | InChI=1S/C29H34N6O7S2/c1-5-16-14-29(16,27(39)34-44(30,40)41)33-24(37)20-13-17(15-35(20)26(38)23(36)28(2,3)4)42-25-22(21-11-8-12-43-21)31-18-9-6-7-10-19(18)32-25/h5-12,16-17,20,23,36H,1,13-15H2,2-4H3,(H,33,37)(H,34,39)(H2,30,40,41)/t16-,17-,20+,23-,29-/m1/s1 |
| InChIKey | YLQFNHBOKOXMGS-OSXHTNSCSA-N |
| XLogP | 1.49 |
| TPSA | 193.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|