C16H12F3N5O — CID 25105991
4-(7-amino-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol (PubChem CID 25105991) has the molecular formula C16H12F3N5O and a molecular weight of 347.30 g/mol. Its IUPAC name is 4-(7-amino-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol.
| Compound Name | 4-(7-amino-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 25105991 |
| Molecular Formula | C16H12F3N5O |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-(7-amino-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1,1,1-trifluoro-2-phenylbut-3-yn-2-ol |
| SMILES | Cc1nc2ncnn2c(N)c1C#CC(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H12F3N5O/c1-10-12(13(20)24-14(23-10)21-9-22-24)7-8-15(25,16(17,18)19)11-5-3-2-4-6-11/h2-6,9,25H,20H2,1H3 |
| InChIKey | ZPYYTTPTYAJYGJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|