About 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid
2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid (PubChem CID 25106081) has the molecular formula C21H17N3O4
and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid |
| PubChem CID | 25106081 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid |
| SMILES | Cc1oncc1C(=O)Nc1ccc(-n2cc(CC(=O)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H17N3O4/c1-13-18(11-22-28-13)21(27)23-15-6-8-16(9-7-15)24-12-14(10-20(25)26)17-4-2-3-5-19(17)24/h2-9,11-12H,10H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | DSUZSHCTOCSMNT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid?
The IUPAC name of 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid (CID 25106081) is 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid.
What is the SMILES notation for 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid?
The canonical SMILES for 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid is Cc1oncc1C(=O)Nc1ccc(-n2cc(CC(=O)O)c3ccccc32)cc1.
What is the InChIKey of 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid?
The InChIKey is DSUZSHCTOCSMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O4/c1-13-18(11-22-28-13)21(27)23-15-6-8-16(9-7-15)24-12-14(10-20(25)26)17-4-2-3-5-19(17)24/h2-9,11-12H,10H2,1H3,(H,23,27)(H,25,26).
What are the key properties of 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid?
2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid has a molecular weight of 375.38 g/mol, XLogP of 3.81, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]indol-3-yl]acetic acid is sourced from PubChem (CID 25106081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).