C20H18F3N3O — CID 25106308
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide (PubChem CID 25106308) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 25106308 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)NCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H18F3N3O/c1-12-16(13(2)26(25-12)15-6-4-3-5-7-15)10-18(27)24-11-14-8-9-17(21)20(23)19(14)22/h3-9H,10-11H2,1-2H3,(H,24,27) |
| InChIKey | CQVSLOQKVIUCOO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|