C30H46N4O4S — CID 25106452
1-[4-[dimethylamino(phenyl)methyl]cyclohexyl]-3-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]urea (PubChem CID 25106452) has the molecular formula C30H46N4O4S and a molecular weight of 558.79 g/mol. Its IUPAC name is 1-[4-[dimethylamino(phenyl)methyl]cyclohexyl]-3-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]urea.
| Compound Name | 1-[4-[dimethylamino(phenyl)methyl]cyclohexyl]-3-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]urea |
|---|---|
| PubChem CID | 25106452 |
| Molecular Formula | C30H46N4O4S |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 1-[4-[dimethylamino(phenyl)methyl]cyclohexyl]-3-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]urea |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCCNC(=O)NC2CCC(C(c3ccccc3)N(C)C)CC2)c(C)c1C |
| InChI | InChI=1S/C30H46N4O4S/c1-21-20-27(38-7)22(2)23(3)29(21)39(36,37)34(6)19-11-18-31-30(35)32-26-16-14-25(15-17-26)28(33(4)5)24-12-9-8-10-13-24/h8-10,12-13,20,25-26,28H,11,14-19H2,1-7H3,(H2,31,32,35) |
| InChIKey | QGWKSNOHMBWION-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|