C32H48N4O4S — CID 25106533
1-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]-3-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]urea (PubChem CID 25106533) has the molecular formula C32H48N4O4S and a molecular weight of 584.83 g/mol. Its IUPAC name is 1-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]-3-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]urea.
| Compound Name | 1-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]-3-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]urea |
|---|---|
| PubChem CID | 25106533 |
| Molecular Formula | C32H48N4O4S |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 1-[3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-methylamino]propyl]-3-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]urea |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCCNC(=O)NC2CCC(C(c3ccccc3)N3CCCC3)CC2)c(C)c1C |
| InChI | InChI=1S/C32H48N4O4S/c1-23-22-29(40-5)24(2)25(3)31(23)41(38,39)35(4)19-11-18-33-32(37)34-28-16-14-27(15-17-28)30(36-20-9-10-21-36)26-12-7-6-8-13-26/h6-8,12-13,22,27-28,30H,9-11,14-21H2,1-5H3,(H2,33,34,37) |
| InChIKey | YLJRDSXFIGHBDI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|