About 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide
2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide (PubChem CID 25106741) has the molecular formula C21H21ClFN3O
and a molecular weight of 385.87 g/mol. Its IUPAC name is 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide |
| PubChem CID | 25106741 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CC(=O)NCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H21ClFN3O/c1-14-19(15(2)26(25-14)13-16-6-4-3-5-7-16)11-21(27)24-12-17-8-9-18(23)10-20(17)22/h3-10H,11-13H2,1-2H3,(H,24,27) |
| InChIKey | XOUOKRMHXOPQDE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide?
The IUPAC name of 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide (CID 25106741) is 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide.
What is the SMILES notation for 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide?
The canonical SMILES for 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide is Cc1nn(Cc2ccccc2)c(C)c1CC(=O)NCc1ccc(F)cc1Cl.
What is the InChIKey of 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide?
The InChIKey is XOUOKRMHXOPQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClFN3O/c1-14-19(15(2)26(25-14)13-16-6-4-3-5-7-16)11-21(27)24-12-17-8-9-18(23)10-20(17)22/h3-10H,11-13H2,1-2H3,(H,24,27).
What are the key properties of 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide?
2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide has a molecular weight of 385.87 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2-chloro-4-fluorophenyl)methyl]acetamide is sourced from PubChem (CID 25106741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).