C14H30O2Si2 — CID 25107473
(2E,4S,5S,6E)-1,8-bis(trimethylsilyl)octa-2,6-diene-4,5-diol (PubChem CID 25107473) has the molecular formula C14H30O2Si2 and a molecular weight of 286.56 g/mol. Its IUPAC name is (2E,4S,5S,6E)-1,8-bis(trimethylsilyl)octa-2,6-diene-4,5-diol.
| Compound Name | (2E,4S,5S,6E)-1,8-bis(trimethylsilyl)octa-2,6-diene-4,5-diol |
|---|---|
| PubChem CID | 25107473 |
| Molecular Formula | C14H30O2Si2 |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2E,4S,5S,6E)-1,8-bis(trimethylsilyl)octa-2,6-diene-4,5-diol |
| SMILES | C[Si](C)(C)C/C=C/[C@H](O)[C@@H](O)/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si2/c1-17(2,3)11-7-9-13(15)14(16)10-8-12-18(4,5)6/h7-10,13-16H,11-12H2,1-6H3/b9-7+,10-8+/t13-,14-/m0/s1 |
| InChIKey | FEFOJKGXOHQTSH-FETIZUMASA-N |
| XLogP | 3.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|