C20H21F6NO — CID 25107513
2-[4-[benzyl(butyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 25107513) has the molecular formula C20H21F6NO and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-[4-[benzyl(butyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[benzyl(butyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 25107513 |
| Molecular Formula | C20H21F6NO |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[4-[benzyl(butyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCCN(Cc1ccccc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F6NO/c1-2-3-13-27(14-15-7-5-4-6-8-15)17-11-9-16(10-12-17)18(28,19(21,22)23)20(24,25)26/h4-12,28H,2-3,13-14H2,1H3 |
| InChIKey | FXKCJMNHVGXENM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|