C19H28O2 — CID 25107593
(2R,6R)-2-[(1E,3Z,5R)-3-ethyl-5-methylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran (PubChem CID 25107593) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2R,6R)-2-[(1E,3Z,5R)-3-ethyl-5-methylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-[(1E,3Z,5R)-3-ethyl-5-methylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 25107593 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2R,6R)-2-[(1E,3Z,5R)-3-ethyl-5-methylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
| SMILES | C#CC[C@@H](C)/C=C(\C=C\[C@H]1CC=C[C@H](OC(C)C)O1)CC |
| InChI | InChI=1S/C19H28O2/c1-6-9-16(5)14-17(7-2)12-13-18-10-8-11-19(21-18)20-15(3)4/h1,8,11-16,18-19H,7,9-10H2,2-5H3/b13-12+,17-14-/t16-,18-,19-/m1/s1 |
| InChIKey | IHRMINNEYQULOO-UWAAZQACSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|