About N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide
N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide (PubChem CID 25107695) has the molecular formula C20H28N2O4S
and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
| PubChem CID | 25107695 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(CCNC[C@H](O)COc2ccc(NS(C)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C20H28N2O4S/c1-15-4-5-17(12-16(15)2)10-11-21-13-19(23)14-26-20-8-6-18(7-9-20)22-27(3,24)25/h4-9,12,19,21-23H,10-11,13-14H2,1-3H3/t19-/m0/s1 |
| InChIKey | YSMYHFYQNPTSTR-IBGZPJMESA-N |
| XLogP | 2.25 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide?
The IUPAC name of N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide (CID 25107695) is N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide?
The canonical SMILES for N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide is Cc1ccc(CCNC[C@H](O)COc2ccc(NS(C)(=O)=O)cc2)cc1C.
What is the InChIKey of N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide?
The InChIKey is YSMYHFYQNPTSTR-IBGZPJMESA-N. The full InChI is InChI=1S/C20H28N2O4S/c1-15-4-5-17(12-16(15)2)10-11-21-13-19(23)14-26-20-8-6-18(7-9-20)22-27(3,24)25/h4-9,12,19,21-23H,10-11,13-14H2,1-3H3/t19-/m0/s1.
What are the key properties of N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide?
N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide has a molecular weight of 392.52 g/mol, XLogP of 2.25, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2S)-3-[2-(3,4-dimethylphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide is sourced from PubChem (CID 25107695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).