C23H42O6Si — CID 25107879
[(1S)-1-[(4R,5S)-5-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 25107879) has the molecular formula C23H42O6Si and a molecular weight of 442.67 g/mol. Its IUPAC name is [(1S)-1-[(4R,5S)-5-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-1-[(4R,5S)-5-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 25107879 |
| Molecular Formula | C23H42O6Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | [(1S)-1-[(4R,5S)-5-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C23H42O6Si/c1-12-13-15(29-30(10,11)21(3,4)5)18-19(27-22(6,7)26-18)16-14(2)17-20(24-16)28-23(8,9)25-17/h12,14-20H,1,13H2,2-11H3/t14-,15+,16+,17-,18+,19+,20-/m1/s1 |
| InChIKey | AVLBLLZFUQUZPU-KOGWCRERSA-N |
| XLogP | 4.99 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|