C40H60N4 — CID 25107927
5,10,15,20-tetratert-butyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 25107927) has the molecular formula C40H60N4 and a molecular weight of 596.95 g/mol. Its IUPAC name is 5,10,15,20-tetratert-butyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetratert-butyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 25107927 |
| Molecular Formula | C40H60N4 |
| Molecular Weight | 596.95 g/mol |
| Exact Mass | 596.48 |
| IUPAC Name | 5,10,15,20-tetratert-butyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC(C)(C)C1(C)c2ccc([nH]2)C(C)(C(C)(C)C)c2ccc([nH]2)C(C)(C(C)(C)C)c2ccc([nH]2)C(C)(C(C)(C)C)c2ccc1[nH]2 |
| InChI | InChI=1S/C40H60N4/c1-33(2,3)37(13)25-17-19-27(41-25)38(14,34(4,5)6)29-21-23-31(43-29)40(16,36(10,11)12)32-24-22-30(44-32)39(15,35(7,8)9)28-20-18-26(37)42-28/h17-24,41-44H,1-16H3 |
| InChIKey | MJXHFLLWNIMADG-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.95 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |