C29H35F3N2O2 — CID 25108099
N,N-dihexyl-2-oxo-2-[2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetamide (PubChem CID 25108099) has the molecular formula C29H35F3N2O2 and a molecular weight of 500.61 g/mol. Its IUPAC name is N,N-dihexyl-2-oxo-2-[2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetamide.
| Compound Name | N,N-dihexyl-2-oxo-2-[2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 25108099 |
| Molecular Formula | C29H35F3N2O2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | N,N-dihexyl-2-oxo-2-[2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C(=O)c1c(-c2ccc(C(F)(F)F)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C29H35F3N2O2/c1-3-5-7-11-19-34(20-12-8-6-4-2)28(36)27(35)25-23-13-9-10-14-24(23)33-26(25)21-15-17-22(18-16-21)29(30,31)32/h9-10,13-18,33H,3-8,11-12,19-20H2,1-2H3 |
| InChIKey | ULPJVYLJBBWKTQ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|