C15H24O — CID 25108316
2-[(1R,4R,7R)-5-methyl-7-propan-2-yl-2-bicyclo[2.2.2]octa-2,5-dienyl]propan-2-ol (PubChem CID 25108316) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-[(1R,4R,7R)-5-methyl-7-propan-2-yl-2-bicyclo[2.2.2]octa-2,5-dienyl]propan-2-ol.
| Compound Name | 2-[(1R,4R,7R)-5-methyl-7-propan-2-yl-2-bicyclo[2.2.2]octa-2,5-dienyl]propan-2-ol |
|---|---|
| PubChem CID | 25108316 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-[(1R,4R,7R)-5-methyl-7-propan-2-yl-2-bicyclo[2.2.2]octa-2,5-dienyl]propan-2-ol |
| SMILES | CC1=C[C@@H]2C(C(C)(C)O)=C[C@H]1C[C@@H]2C(C)C |
| InChI | InChI=1S/C15H24O/c1-9(2)12-7-11-8-14(15(4,5)16)13(12)6-10(11)3/h6,8-9,11-13,16H,7H2,1-5H3/t11-,12-,13+/m1/s1 |
| InChIKey | NDYITPSGAZLHSH-UPJWGTAASA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|