C30H37NO9 — CID 25108434
[(S)-[(4S)-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-oxazolidin-4-yl]-[(1R)-2-oxocyclohexyl]methyl] benzoate (PubChem CID 25108434) has the molecular formula C30H37NO9 and a molecular weight of 555.62 g/mol. Its IUPAC name is [(S)-[(4S)-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-oxazolidin-4-yl]-[(1R)-2-oxocyclohexyl]methyl] benzoate.
| Compound Name | [(S)-[(4S)-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-oxazolidin-4-yl]-[(1R)-2-oxocyclohexyl]methyl] benzoate |
|---|---|
| PubChem CID | 25108434 |
| Molecular Formula | C30H37NO9 |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | [(S)-[(4S)-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-oxazolidin-4-yl]-[(1R)-2-oxocyclohexyl]methyl] benzoate |
| SMILES | COCCOCOC[C@@]1([C@@H](OC(=O)c2ccccc2)[C@H]2CCCCC2=O)COC(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H37NO9/c1-35-16-17-37-21-38-19-30(20-39-29(34)31(30)18-22-12-14-24(36-2)15-13-22)27(25-10-6-7-11-26(25)32)40-28(33)23-8-4-3-5-9-23/h3-5,8-9,12-15,25,27H,6-7,10-11,16-21H2,1-2H3/t25-,27-,30-/m0/s1 |
| InChIKey | VPGVBSZOBKDTPO-XXJPWZBZSA-N |
| XLogP | 4.01 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|