About 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate
1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate (PubChem CID 2510911) has the molecular formula C19H18N2O5S
and a molecular weight of 386.43 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate.
Molecular Properties
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate |
| PubChem CID | 2510911 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1cc(OC)cc(C(=O)NCC(=O)OCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H18N2O5S/c1-24-13-7-12(8-14(9-13)25-2)19(23)20-10-18(22)26-11-17-21-15-5-3-4-6-16(15)27-17/h3-9H,10-11H2,1-2H3,(H,20,23) |
| InChIKey | XIAYOMGJJOAMNX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate (CID 2510911) is 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate is COc1cc(OC)cc(C(=O)NCC(=O)OCc2nc3ccccc3s2)c1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The InChIKey is XIAYOMGJJOAMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5S/c1-24-13-7-12(8-14(9-13)25-2)19(23)20-10-18(22)26-11-17-21-15-5-3-4-6-16(15)27-17/h3-9H,10-11H2,1-2H3,(H,20,23).
What are the key properties of 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate has a molecular weight of 386.43 g/mol, XLogP of 2.79, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate is sourced from PubChem (CID 2510911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).