C24H27N3O2 — CID 25109129
[(4R,4aR,8aR)-4-benzyl-4-hydroxy-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1H-benzimidazol-4-yl)methanone (PubChem CID 25109129) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is [(4R,4aR,8aR)-4-benzyl-4-hydroxy-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1H-benzimidazol-4-yl)methanone.
| Compound Name | [(4R,4aR,8aR)-4-benzyl-4-hydroxy-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1H-benzimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 25109129 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [(4R,4aR,8aR)-4-benzyl-4-hydroxy-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1H-benzimidazol-4-yl)methanone |
| SMILES | O=C(c1cccc2[nH]cnc12)N1CC[C@](O)(Cc2ccccc2)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C24H27N3O2/c28-23(18-9-6-11-20-22(18)26-16-25-20)27-14-13-24(29,15-17-7-2-1-3-8-17)19-10-4-5-12-21(19)27/h1-3,6-9,11,16,19,21,29H,4-5,10,12-15H2,(H,25,26)/t19-,21-,24+/m1/s1 |
| InChIKey | KPEJSSVDNRINMG-ZYKOEDHHSA-N |
| XLogP | 3.94 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |