About 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid
4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid (PubChem CID 25109448) has the molecular formula C25H24N2O3S
and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid.
Molecular Properties
| Compound Name | 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid |
| PubChem CID | 25109448 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(OCCN(c2ccccc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H24N2O3S/c28-24(29)12-6-7-19-13-15-21(16-14-19)30-18-17-27(20-8-2-1-3-9-20)25-26-22-10-4-5-11-23(22)31-25/h1-5,8-11,13-16H,6-7,12,17-18H2,(H,28,29) |
| InChIKey | SWPBTPOWFVPQIU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid?
The IUPAC name of 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid (CID 25109448) is 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid.
What is the SMILES notation for 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid?
The canonical SMILES for 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid is O=C(O)CCCc1ccc(OCCN(c2ccccc2)c2nc3ccccc3s2)cc1.
What is the InChIKey of 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid?
The InChIKey is SWPBTPOWFVPQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O3S/c28-24(29)12-6-7-19-13-15-21(16-14-19)30-18-17-27(20-8-2-1-3-9-20)25-26-22-10-4-5-11-23(22)31-25/h1-5,8-11,13-16H,6-7,12,17-18H2,(H,28,29).
What are the key properties of 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid?
4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid has a molecular weight of 432.55 g/mol, XLogP of 5.92, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-[N-(1,3-benzothiazol-2-yl)anilino]ethoxy]phenyl]butanoic acid is sourced from PubChem (CID 25109448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).