C18H21FN2O2S — CID 25109651
3-(6-fluoro-2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine (PubChem CID 25109651) has the molecular formula C18H21FN2O2S and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-(6-fluoro-2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(6-fluoro-2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 25109651 |
| Molecular Formula | C18H21FN2O2S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-(6-fluoro-2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1Cc2cc(F)ccc2N(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C18H21FN2O2S/c1-20-11-5-8-17-13-14-12-15(19)9-10-18(14)21(24(17,22)23)16-6-3-2-4-7-16/h2-4,6-7,9-10,12,17,20H,5,8,11,13H2,1H3 |
| InChIKey | JVDABEHLVBLHMY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|