About 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone
2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone (PubChem CID 25110016) has the molecular formula C17H23BrO
and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone |
| PubChem CID | 25110016 |
| Molecular Formula | C17H23BrO |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone |
| SMILES | CC(C)(C)c1cc(C(=O)CBr)c2c(c1)C(C)(C)CC2 |
| InChI | InChI=1S/C17H23BrO/c1-16(2,3)11-8-13(15(19)10-18)12-6-7-17(4,5)14(12)9-11/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | GUAYVLRUUJUZHH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone?
The IUPAC name of 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone (CID 25110016) is 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone.
What is the SMILES notation for 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone?
The canonical SMILES for 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone is CC(C)(C)c1cc(C(=O)CBr)c2c(c1)C(C)(C)CC2.
What is the InChIKey of 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone?
The InChIKey is GUAYVLRUUJUZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23BrO/c1-16(2,3)11-8-13(15(19)10-18)12-6-7-17(4,5)14(12)9-11/h8-9H,6-7,10H2,1-5H3.
What are the key properties of 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone?
2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone has a molecular weight of 323.27 g/mol, XLogP of 4.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone is sourced from PubChem (CID 25110016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).