C20H21N3O3 — CID 25110308
5-(3,4-diethoxyphenyl)-3-(2,3-dihydro-1H-indol-4-yl)-1,2,4-oxadiazole (PubChem CID 25110308) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 5-(3,4-diethoxyphenyl)-3-(2,3-dihydro-1H-indol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(3,4-diethoxyphenyl)-3-(2,3-dihydro-1H-indol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25110308 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-(3,4-diethoxyphenyl)-3-(2,3-dihydro-1H-indol-4-yl)-1,2,4-oxadiazole |
| SMILES | CCOc1ccc(-c2nc(-c3cccc4c3CCN4)no2)cc1OCC |
| InChI | InChI=1S/C20H21N3O3/c1-3-24-17-9-8-13(12-18(17)25-4-2)20-22-19(23-26-20)15-6-5-7-16-14(15)10-11-21-16/h5-9,12,21H,3-4,10-11H2,1-2H3 |
| InChIKey | FBBKDHZKADSFCW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |