C27H35N5O3 — CID 25110395
N-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 25110395) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 25110395 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | N-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCOc1ccc(-c2nc(-c3ccc4[nH]cc(CNCCN(CC)CC)c4c3)no2)cc1OCC |
| InChI | InChI=1S/C27H35N5O3/c1-5-32(6-2)14-13-28-17-21-18-29-23-11-9-19(15-22(21)23)26-30-27(35-31-26)20-10-12-24(33-7-3)25(16-20)34-8-4/h9-12,15-16,18,28-29H,5-8,13-14,17H2,1-4H3 |
| InChIKey | QOCMZNWPUFMGDJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|