C23H26N4O4 — CID 25110409
2-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methylamino]ethanol (PubChem CID 25110409) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methylamino]ethanol.
| Compound Name | 2-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 25110409 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methylamino]ethanol |
| SMILES | CCOc1ccc(-c2nc(-c3ccc4[nH]cc(CNCCO)c4c3)no2)cc1OCC |
| InChI | InChI=1S/C23H26N4O4/c1-3-29-20-8-6-16(12-21(20)30-4-2)23-26-22(27-31-23)15-5-7-19-18(11-15)17(14-25-19)13-24-9-10-28/h5-8,11-12,14,24-25,28H,3-4,9-10,13H2,1-2H3 |
| InChIKey | PHTHPSFVPAIWBY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|