C14H15N7O3 — CID 25110693
8-(4-methylpiperazin-1-yl)-3-nitro-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium (PubChem CID 25110693) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 8-(4-methylpiperazin-1-yl)-3-nitro-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium.
| Compound Name | 8-(4-methylpiperazin-1-yl)-3-nitro-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium |
|---|---|
| PubChem CID | 25110693 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 8-(4-methylpiperazin-1-yl)-3-nitro-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium |
| SMILES | CN1CCN(c2ccc3c(c2)n2ncc([N+](=O)[O-])c2n[n+]3[O-])CC1 |
| InChI | InChI=1S/C14H15N7O3/c1-17-4-6-18(7-5-17)10-2-3-11-12(8-10)19-14(16-20(11)22)13(9-15-19)21(23)24/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | ZFHNGEAXMXWKHV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|