C28H36I2N2 — CID 25110792
1,10-diazoniatricyclo[23.3.1.110,14]triaconta-1(28),10,12,14(30),25(29),26-hexaen-15,23-diyne diiodide (PubChem CID 25110792) has the molecular formula C28H36I2N2 and a molecular weight of 654.42 g/mol. Its IUPAC name is 1,10-diazoniatricyclo[23.3.1.110,14]triaconta-1(28),10,12,14(30),25(29),26-hexaen-15,23-diyne diiodide.
| Compound Name | 1,10-diazoniatricyclo[23.3.1.110,14]triaconta-1(28),10,12,14(30),25(29),26-hexaen-15,23-diyne diiodide |
|---|---|
| PubChem CID | 25110792 |
| Molecular Formula | C28H36I2N2 |
| Molecular Weight | 654.42 g/mol |
| Exact Mass | 654.10 |
| IUPAC Name | 1,10-diazoniatricyclo[23.3.1.110,14]triaconta-1(28),10,12,14(30),25(29),26-hexaen-15,23-diyne diiodide |
| SMILES | C1#Cc2ccc[n+](c2)CCCCCCCC[n+]2cccc(c2)C#CCCCCCC1.[I-].[I-] |
| InChI | InChI=1S/C28H36N2.2HI/c1-2-4-8-12-18-28-20-16-24-30(26-28)22-14-10-6-5-9-13-21-29-23-15-19-27(25-29)17-11-7-3-1;;/h15-16,19-20,23-26H,1-10,13-14,21-22H2;2*1H/q+2;;/p-2 |
| InChIKey | IHKSHQCSLZHLAA-UHFFFAOYSA-L |
| XLogP | -0.63 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.42 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|