About 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine
2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine (PubChem CID 25110809) has the molecular formula C17H14Cl2N2
and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine |
| PubChem CID | 25110809 |
| Molecular Formula | C17H14Cl2N2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine |
| SMILES | Clc1ccc(C2=NCCCN=C2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2/c18-13-8-6-12(7-9-13)16-17(21-11-3-10-20-16)14-4-1-2-5-15(14)19/h1-2,4-9H,3,10-11H2 |
| InChIKey | DDXOEFCWUNIMJN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine?
The IUPAC name of 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine (CID 25110809) is 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine.
What is the SMILES notation for 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine?
The canonical SMILES for 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine is Clc1ccc(C2=NCCCN=C2c2ccccc2Cl)cc1.
What is the InChIKey of 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine?
The InChIKey is DDXOEFCWUNIMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N2/c18-13-8-6-12(7-9-13)16-17(21-11-3-10-20-16)14-4-1-2-5-15(14)19/h1-2,4-9H,3,10-11H2.
What are the key properties of 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine?
2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine has a molecular weight of 317.22 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-3-(4-chlorophenyl)-6,7-dihydro-5H-1,4-diazepine is sourced from PubChem (CID 25110809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).