About N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine
N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine (PubChem CID 25110961) has the molecular formula C18H20N2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine.
Molecular Properties
| Compound Name | N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine |
| PubChem CID | 25110961 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine |
| SMILES | CCC1N=C(Nc2c(C)cccc2C)Sc2ccccc21 |
| InChI | InChI=1S/C18H20N2S/c1-4-15-14-10-5-6-11-16(14)21-18(19-15)20-17-12(2)8-7-9-13(17)3/h5-11,15H,4H2,1-3H3,(H,19,20) |
| InChIKey | AAMCPXBVFMAPTK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine?
The IUPAC name of N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine (CID 25110961) is N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine.
What is the SMILES notation for N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine?
The canonical SMILES for N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine is CCC1N=C(Nc2c(C)cccc2C)Sc2ccccc21.
What is the InChIKey of N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine?
The InChIKey is AAMCPXBVFMAPTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2S/c1-4-15-14-10-5-6-11-16(14)21-18(19-15)20-17-12(2)8-7-9-13(17)3/h5-11,15H,4H2,1-3H3,(H,19,20).
What are the key properties of N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine?
N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine has a molecular weight of 296.44 g/mol, XLogP of 5.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylphenyl)-4-ethyl-4H-1,3-benzothiazin-2-amine is sourced from PubChem (CID 25110961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).