About [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate
[2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 2511118) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate |
| PubChem CID | 2511118 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | Cc1cccc(C)c1NC(=O)COC(=O)C1CC1 |
| InChI | InChI=1S/C14H17NO3/c1-9-4-3-5-10(2)13(9)15-12(16)8-18-14(17)11-6-7-11/h3-5,11H,6-8H2,1-2H3,(H,15,16) |
| InChIKey | BEXROOFGTVBIRG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate?
The IUPAC name of [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate (CID 2511118) is [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate.
What is the SMILES notation for [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate?
The canonical SMILES for [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate is Cc1cccc(C)c1NC(=O)COC(=O)C1CC1.
What is the InChIKey of [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate?
The InChIKey is BEXROOFGTVBIRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-9-4-3-5-10(2)13(9)15-12(16)8-18-14(17)11-6-7-11/h3-5,11H,6-8H2,1-2H3,(H,15,16).
What are the key properties of [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate?
[2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate has a molecular weight of 247.29 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylanilino)-2-oxoethyl] cyclopropanecarboxylate is sourced from PubChem (CID 2511118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).