About ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate
ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate (PubChem CID 25111245) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate |
| PubChem CID | 25111245 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/N1CCCc2ccccc21)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-3-25-21(23)19(16-10-12-18(24-2)13-11-16)15-22-14-6-8-17-7-4-5-9-20(17)22/h4-5,7,9-13,15H,3,6,8,14H2,1-2H3/b19-15+ |
| InChIKey | DUEGAKJPWMLZGB-XDJHFCHBSA-N |
| XLogP | 4.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate?
The IUPAC name of ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate (CID 25111245) is ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate.
What is the SMILES notation for ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate?
The canonical SMILES for ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate is CCOC(=O)/C(=C/N1CCCc2ccccc21)c1ccc(OC)cc1.
What is the InChIKey of ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate?
The InChIKey is DUEGAKJPWMLZGB-XDJHFCHBSA-N. The full InChI is InChI=1S/C21H23NO3/c1-3-25-21(23)19(16-10-12-18(24-2)13-11-16)15-22-14-6-8-17-7-4-5-9-20(17)22/h4-5,7,9-13,15H,3,6,8,14H2,1-2H3/b19-15+.
What are the key properties of ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate?
ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate has a molecular weight of 337.42 g/mol, XLogP of 4.05, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-(3,4-dihydro-2H-quinolin-1-yl)-2-(4-methoxyphenyl)prop-2-enoate is sourced from PubChem (CID 25111245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).