C19H24O3 — CID 25111561
2-[(1E,5E)-hepta-1,5-dienyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde (PubChem CID 25111561) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[(1E,5E)-hepta-1,5-dienyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde.
| Compound Name | 2-[(1E,5E)-hepta-1,5-dienyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde |
|---|---|
| PubChem CID | 25111561 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[(1E,5E)-hepta-1,5-dienyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde |
| SMILES | C/C=C/CC/C=C/c1c(O)cc(CC=C(C)C)c(O)c1C=O |
| InChI | InChI=1S/C19H24O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h4-5,8-10,12-13,21-22H,6-7,11H2,1-3H3/b5-4+,9-8+ |
| InChIKey | YMWWYKZCNJAKQU-KQWYESAVSA-N |
| XLogP | 4.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|