C10H13ClO4 — CID 25111598
(2R,3S,5E,7S,8Z)-4-chloro-3,7-dihydroxy-2-methyl-2,3,4,7-tetrahydrooxecin-10-one (PubChem CID 25111598) has the molecular formula C10H13ClO4 and a molecular weight of 232.66 g/mol. Its IUPAC name is (2R,3S,5E,7S,8Z)-4-chloro-3,7-dihydroxy-2-methyl-2,3,4,7-tetrahydrooxecin-10-one.
| Compound Name | (2R,3S,5E,7S,8Z)-4-chloro-3,7-dihydroxy-2-methyl-2,3,4,7-tetrahydrooxecin-10-one |
|---|---|
| PubChem CID | 25111598 |
| Molecular Formula | C10H13ClO4 |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (2R,3S,5E,7S,8Z)-4-chloro-3,7-dihydroxy-2-methyl-2,3,4,7-tetrahydrooxecin-10-one |
| SMILES | C[C@H]1OC(=O)/C=C\[C@H](O)/C=C/C(Cl)[C@H]1O |
| InChI | InChI=1S/C10H13ClO4/c1-6-10(14)8(11)4-2-7(12)3-5-9(13)15-6/h2-8,10,12,14H,1H3/b4-2+,5-3-/t6-,7-,8?,10+/m1/s1 |
| InChIKey | IIIFVUMJBALUGH-NMTNZHRMSA-N |
| XLogP | 0.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|