C18H22O7 — CID 25111601
[(2R,3aS,9bS)-7,8-dimethoxy-5-oxo-2-propyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-6-yl] acetate (PubChem CID 25111601) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is [(2R,3aS,9bS)-7,8-dimethoxy-5-oxo-2-propyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-6-yl] acetate.
| Compound Name | [(2R,3aS,9bS)-7,8-dimethoxy-5-oxo-2-propyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-6-yl] acetate |
|---|---|
| PubChem CID | 25111601 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [(2R,3aS,9bS)-7,8-dimethoxy-5-oxo-2-propyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-6-yl] acetate |
| SMILES | CCC[C@@H]1C[C@@H]2OC(=O)c3c(cc(OC)c(OC)c3OC(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C18H22O7/c1-5-6-10-7-13-15(24-10)11-8-12(21-3)16(22-4)17(23-9(2)19)14(11)18(20)25-13/h8,10,13,15H,5-7H2,1-4H3/t10-,13+,15+/m1/s1 |
| InChIKey | GYPXYJUUIBLXBA-DGFSRKRXSA-N |
| XLogP | 2.80 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|