C24H26N2O3 — CID 25111669
N-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]pyridine-3-carboxamide (PubChem CID 25111669) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25111669 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]pyridine-3-carboxamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)c(NC(=O)c5cccnc5)c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H26N2O3/c1-24-11-10-16-15-6-8-20(27)22(26-23(29)14-3-2-12-25-13-14)18(15)5-4-17(16)19(24)7-9-21(24)28/h2-3,6,8,12-13,16-17,19,27H,4-5,7,9-11H2,1H3,(H,26,29)/t16-,17-,19+,24+/m1/s1 |
| InChIKey | NCAWXXMHTCNOQX-CVJORQDNSA-N |
| XLogP | 4.46 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|