C18H21NO6 — CID 25111816
3-[3-[(1S)-1,4-dimethyl-2-oxocyclohex-3-en-1-yl]propanoylamino]-2,4-dihydroxybenzoic acid (PubChem CID 25111816) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-[3-[(1S)-1,4-dimethyl-2-oxocyclohex-3-en-1-yl]propanoylamino]-2,4-dihydroxybenzoic acid.
| Compound Name | 3-[3-[(1S)-1,4-dimethyl-2-oxocyclohex-3-en-1-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 25111816 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[3-[(1S)-1,4-dimethyl-2-oxocyclohex-3-en-1-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
| SMILES | CC1=CC(=O)[C@](C)(CCC(=O)Nc2c(O)ccc(C(=O)O)c2O)CC1 |
| InChI | InChI=1S/C18H21NO6/c1-10-5-7-18(2,13(21)9-10)8-6-14(22)19-15-12(20)4-3-11(16(15)23)17(24)25/h3-4,9,20,23H,5-8H2,1-2H3,(H,19,22)(H,24,25)/t18-/m0/s1 |
| InChIKey | VTPHWGOCFATMRF-SFHVURJKSA-N |
| XLogP | 2.83 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|