C21H33NO4 — CID 25111838
dipropan-2-yl 2-[(2R,3aR,7S,7aR)-2-cyano-7,7a-dimethyl-3,3a,4,5,6,7-hexahydro-1H-inden-2-yl]propanedioate (PubChem CID 25111838) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is dipropan-2-yl 2-[(2R,3aR,7S,7aR)-2-cyano-7,7a-dimethyl-3,3a,4,5,6,7-hexahydro-1H-inden-2-yl]propanedioate.
| Compound Name | dipropan-2-yl 2-[(2R,3aR,7S,7aR)-2-cyano-7,7a-dimethyl-3,3a,4,5,6,7-hexahydro-1H-inden-2-yl]propanedioate |
|---|---|
| PubChem CID | 25111838 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | dipropan-2-yl 2-[(2R,3aR,7S,7aR)-2-cyano-7,7a-dimethyl-3,3a,4,5,6,7-hexahydro-1H-inden-2-yl]propanedioate |
| SMILES | CC(C)OC(=O)C(C(=O)OC(C)C)[C@@]1(C#N)C[C@H]2CCC[C@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C21H33NO4/c1-13(2)25-18(23)17(19(24)26-14(3)4)21(12-22)10-16-9-7-8-15(5)20(16,6)11-21/h13-17H,7-11H2,1-6H3/t15-,16+,20+,21-/m0/s1 |
| InChIKey | DCRCPCKJVYPNRQ-HDIOYNLWSA-N |
| XLogP | 4.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|