C25H42O5Si — CID 25111843
(2R,4aR,9aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol (PubChem CID 25111843) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is (2R,4aR,9aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol.
| Compound Name | (2R,4aR,9aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
|---|---|
| PubChem CID | 25111843 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (2R,4aR,9aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
| SMILES | COCOc1cc(CO[Si](C)(C)C(C)(C)C)cc2c1O[C@]1(C)CC[C@@H](O)C(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C25H42O5Si/c1-23(2,3)31(8,9)29-15-17-12-18-14-20-24(4,5)21(26)10-11-25(20,6)30-22(18)19(13-17)28-16-27-7/h12-13,20-21,26H,10-11,14-16H2,1-9H3/t20-,21-,25-/m1/s1 |
| InChIKey | FBOKBTACAXFOLT-DNRQZRRGSA-N |
| XLogP | 5.68 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|