About 2-(2,4-dichlorophenyl)-1,3-dithiane
2-(2,4-dichlorophenyl)-1,3-dithiane (PubChem CID 25111861) has the molecular formula C10H10Cl2S2
and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)-1,3-dithiane |
| PubChem CID | 25111861 |
| Molecular Formula | C10H10Cl2S2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1,3-dithiane |
| SMILES | Clc1ccc(C2SCCCS2)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2S2/c11-7-2-3-8(9(12)6-7)10-13-4-1-5-14-10/h2-3,6,10H,1,4-5H2 |
| InChIKey | JLPOAPDRRRJHNO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4-dichlorophenyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)-1,3-dithiane?
The IUPAC name of 2-(2,4-dichlorophenyl)-1,3-dithiane (CID 25111861) is 2-(2,4-dichlorophenyl)-1,3-dithiane.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-1,3-dithiane?
The canonical SMILES for 2-(2,4-dichlorophenyl)-1,3-dithiane is Clc1ccc(C2SCCCS2)c(Cl)c1.
What is the InChIKey of 2-(2,4-dichlorophenyl)-1,3-dithiane?
The InChIKey is JLPOAPDRRRJHNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2S2/c11-7-2-3-8(9(12)6-7)10-13-4-1-5-14-10/h2-3,6,10H,1,4-5H2.
What are the key properties of 2-(2,4-dichlorophenyl)-1,3-dithiane?
2-(2,4-dichlorophenyl)-1,3-dithiane has a molecular weight of 265.23 g/mol, XLogP of 4.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-1,3-dithiane is sourced from PubChem (CID 25111861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).