C23H24ClF3N4O4 — CID 25112154
ethyl 4-[[2-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3,4-dihydropyrazole-3-carbonyl]amino]benzoate;hydrochloride (PubChem CID 25112154) has the molecular formula C23H24ClF3N4O4 and a molecular weight of 512.92 g/mol. Its IUPAC name is ethyl 4-[[2-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3,4-dihydropyrazole-3-carbonyl]amino]benzoate;hydrochloride.
| Compound Name | ethyl 4-[[2-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3,4-dihydropyrazole-3-carbonyl]amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 25112154 |
| Molecular Formula | C23H24ClF3N4O4 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | ethyl 4-[[2-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3,4-dihydropyrazole-3-carbonyl]amino]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CC=NN2C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)cc1.Cl |
| InChI | InChI=1S/C23H23F3N4O4.ClH/c1-2-34-23(33)13-3-5-16(6-4-13)29-22(32)20-7-8-28-30(20)21(31)11-15(27)9-14-10-18(25)19(26)12-17(14)24;/h3-6,8,10,12,15,20H,2,7,9,11,27H2,1H3,(H,29,32);1H/t15-,20?;/m1./s1 |
| InChIKey | CZXNNUYTIGQYQV-SMRSSTSJSA-N |
| XLogP | 3.19 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|